C26H44O8 — CID 162996953
2-[5-(3,6-dihydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162996953) has the molecular formula C26H44O8 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[5-(3,6-dihydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[5-(3,6-dihydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162996953 |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2-[5-(3,6-dihydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C1C(O)CC2C(C)(C)C(O)CCC2(C)C1CCC(C)=CCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C26H44O8/c1-14(9-11-33-24-23(32)22(31)21(30)18(13-27)34-24)6-7-16-15(2)17(28)12-19-25(3,4)20(29)8-10-26(16,19)5/h9,16-24,27-32H,2,6-8,10-13H2,1,3-5H3 |
| InChIKey | KNUOBVOZKPIYTP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|