C15H24O — CID 162997127
(1aS,4aR,8R,8aR)-4a,8-dimethyl-2-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[1,8a-b]oxirene (PubChem CID 162997127) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1aS,4aR,8R,8aR)-4a,8-dimethyl-2-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[1,8a-b]oxirene.
| Compound Name | (1aS,4aR,8R,8aR)-4a,8-dimethyl-2-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[1,8a-b]oxirene |
|---|---|
| PubChem CID | 162997127 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1aS,4aR,8R,8aR)-4a,8-dimethyl-2-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[1,8a-b]oxirene |
| SMILES | CC(C)C1=CC[C@@]2(C)CCC[C@@H](C)[C@@]23O[C@@H]13 |
| InChI | InChI=1S/C15H24O/c1-10(2)12-7-9-14(4)8-5-6-11(3)15(14)13(12)16-15/h7,10-11,13H,5-6,8-9H2,1-4H3/t11-,13+,14-,15+/m1/s1 |
| InChIKey | GPSWCNUIGKDSHT-BEAPCOKYSA-N |
| XLogP | 3.94 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|