C10H13NO2 — CID 162997410
(3S,4S,5R)-4,5-dimethyl-3-pyrrol-1-yloxolan-2-one (PubChem CID 162997410) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (3S,4S,5R)-4,5-dimethyl-3-pyrrol-1-yloxolan-2-one.
| Compound Name | (3S,4S,5R)-4,5-dimethyl-3-pyrrol-1-yloxolan-2-one |
|---|---|
| PubChem CID | 162997410 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3S,4S,5R)-4,5-dimethyl-3-pyrrol-1-yloxolan-2-one |
| SMILES | C[C@H]1[C@H](n2cccc2)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C10H13NO2/c1-7-8(2)13-10(12)9(7)11-5-3-4-6-11/h3-9H,1-2H3/t7-,8-,9+/m1/s1 |
| InChIKey | FQOZVPSDBMEZFP-HLTSFMKQSA-N |
| XLogP | 1.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |