About methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate
methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate (PubChem CID 162997947) has the molecular formula C12H12O2S
and a molecular weight of 220.29 g/mol. Its IUPAC name is methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate.
Molecular Properties
| Compound Name | methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate |
| PubChem CID | 162997947 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate |
| SMILES | COC(=O)C=CC#CC#CC=C(C)SC |
| InChI | InChI=1S/C12H12O2S/c1-11(15-3)9-7-5-4-6-8-10-12(13)14-2/h8-10H,1-3H3 |
| InChIKey | BKHIATMKQLPPHK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate?
The IUPAC name of methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate (CID 162997947) is methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate.
What is the SMILES notation for methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate?
The canonical SMILES for methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate is COC(=O)C=CC#CC#CC=C(C)SC.
What is the InChIKey of methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate?
The InChIKey is BKHIATMKQLPPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S/c1-11(15-3)9-7-5-4-6-8-10-12(13)14-2/h8-10H,1-3H3.
What are the key properties of methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate?
methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate has a molecular weight of 220.29 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-methylsulfanyldeca-2,8-dien-4,6-diynoate is sourced from PubChem (CID 162997947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).