C20H32O4 — CID 162998051
[(1S,3E,7E,9S,10S)-9-hydroxy-10-[(2S)-1-hydroxypropan-2-yl]-3,7-dimethylcyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162998051) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [(1S,3E,7E,9S,10S)-9-hydroxy-10-[(2S)-1-hydroxypropan-2-yl]-3,7-dimethylcyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3E,7E,9S,10S)-9-hydroxy-10-[(2S)-1-hydroxypropan-2-yl]-3,7-dimethylcyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162998051 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(1S,3E,7E,9S,10S)-9-hydroxy-10-[(2S)-1-hydroxypropan-2-yl]-3,7-dimethylcyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C/C(C)=C/CC/C(C)=C/[C@H](O)[C@@H]1[C@H](C)CO |
| InChI | InChI=1S/C20H32O4/c1-6-15(4)20(23)24-18-11-14(3)9-7-8-13(2)10-17(22)19(18)16(5)12-21/h6,9-10,16-19,21-22H,7-8,11-12H2,1-5H3/b13-10+,14-9+,15-6-/t16-,17+,18+,19+/m1/s1 |
| InChIKey | ZZBPVABDPAAVGR-KTTIMTSMSA-N |
| XLogP | 3.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|