About (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one
(3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one (PubChem CID 162998068) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one |
| PubChem CID | 162998068 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one |
| SMILES | C=C([C@@H](O)C(=O)CC(C)C)[C@@H]1CCC(C)=C[C@H]1O |
| InChI | InChI=1S/C15H24O3/c1-9(2)7-14(17)15(18)11(4)12-6-5-10(3)8-13(12)16/h8-9,12-13,15-16,18H,4-7H2,1-3H3/t12-,13+,15+/m0/s1 |
| InChIKey | QEYJGNKSTHKQTF-GZBFAFLISA-N |
| XLogP | 2.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one?
The IUPAC name of (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one (CID 162998068) is (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one.
What is the SMILES notation for (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one?
The canonical SMILES for (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one is C=C([C@@H](O)C(=O)CC(C)C)[C@@H]1CCC(C)=C[C@H]1O.
What is the InChIKey of (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one?
The InChIKey is QEYJGNKSTHKQTF-GZBFAFLISA-N. The full InChI is InChI=1S/C15H24O3/c1-9(2)7-14(17)15(18)11(4)12-6-5-10(3)8-13(12)16/h8-9,12-13,15-16,18H,4-7H2,1-3H3/t12-,13+,15+/m0/s1.
What are the key properties of (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one?
(3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one has a molecular weight of 252.35 g/mol, XLogP of 2.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-2-[(1S,2R)-2-hydroxy-4-methylcyclohex-3-en-1-yl]-6-methylhept-1-en-4-one is sourced from PubChem (CID 162998068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).