C14H20O4 — CID 162998199
(3S,3aS,5aR,6R,9aS,9bS)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,8,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,9-dione (PubChem CID 162998199) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3S,3aS,5aR,6R,9aS,9bS)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,8,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,9-dione.
| Compound Name | (3S,3aS,5aR,6R,9aS,9bS)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,8,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,9-dione |
|---|---|
| PubChem CID | 162998199 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3S,3aS,5aR,6R,9aS,9bS)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,8,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,9-dione |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@H]1CC[C@@]1(C)[C@H](O)CCC(=O)[C@H]21 |
| InChI | InChI=1S/C14H20O4/c1-7-8-5-6-14(2)10(16)4-3-9(15)11(14)12(8)18-13(7)17/h7-8,10-12,16H,3-6H2,1-2H3/t7-,8-,10+,11+,12-,14-/m0/s1 |
| InChIKey | AOEDWRCLPWZDGO-AICHZTSWSA-N |
| XLogP | 1.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |