C19H24O8 — CID 162998433
[2-(3,4-diacetyloxypent-1-enyl)-6-oxo-2,3-dihydropyran-3-yl] 2-methylbut-2-enoate (PubChem CID 162998433) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is [2-(3,4-diacetyloxypent-1-enyl)-6-oxo-2,3-dihydropyran-3-yl] 2-methylbut-2-enoate.
| Compound Name | [2-(3,4-diacetyloxypent-1-enyl)-6-oxo-2,3-dihydropyran-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162998433 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [2-(3,4-diacetyloxypent-1-enyl)-6-oxo-2,3-dihydropyran-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C=CC(=O)OC1C=CC(OC(C)=O)C(C)OC(C)=O |
| InChI | InChI=1S/C19H24O8/c1-6-11(2)19(23)27-17-9-10-18(22)26-16(17)8-7-15(25-14(5)21)12(3)24-13(4)20/h6-10,12,15-17H,1-5H3 |
| InChIKey | DPFFURFUHJXCKF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|