C21H24O7 — CID 162998508
(1R,6R,7R,8R,9S)-8-(1,3-benzodioxol-5-yl)-9-hydroxy-1,4-dimethoxy-7-methyl-5-prop-2-enyl-2-oxabicyclo[4.2.1]non-4-en-3-one (PubChem CID 162998508) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (1R,6R,7R,8R,9S)-8-(1,3-benzodioxol-5-yl)-9-hydroxy-1,4-dimethoxy-7-methyl-5-prop-2-enyl-2-oxabicyclo[4.2.1]non-4-en-3-one.
| Compound Name | (1R,6R,7R,8R,9S)-8-(1,3-benzodioxol-5-yl)-9-hydroxy-1,4-dimethoxy-7-methyl-5-prop-2-enyl-2-oxabicyclo[4.2.1]non-4-en-3-one |
|---|---|
| PubChem CID | 162998508 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (1R,6R,7R,8R,9S)-8-(1,3-benzodioxol-5-yl)-9-hydroxy-1,4-dimethoxy-7-methyl-5-prop-2-enyl-2-oxabicyclo[4.2.1]non-4-en-3-one |
| SMILES | C=CCC1=C(OC)C(=O)O[C@@]2(OC)[C@@H](O)[C@@H]1[C@@H](C)[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H24O7/c1-5-6-13-16-11(2)17(12-7-8-14-15(9-12)27-10-26-14)21(25-4,19(16)22)28-20(23)18(13)24-3/h5,7-9,11,16-17,19,22H,1,6,10H2,2-4H3/t11-,16-,17-,19+,21-/m1/s1 |
| InChIKey | PPOVKVBQFPRPNH-LNGDSTGCSA-N |
| XLogP | 2.50 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|