C23H34O11 — CID 162998570
[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4R)-4-methyl-6-[(2R,3R)-4-methylidene-5-oxo-2-(2-oxopropyl)oxolan-3-yl]-5-oxohexoxy]oxan-2-yl]methyl acetate (PubChem CID 162998570) has the molecular formula C23H34O11 and a molecular weight of 486.51 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4R)-4-methyl-6-[(2R,3R)-4-methylidene-5-oxo-2-(2-oxopropyl)oxolan-3-yl]-5-oxohexoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4R)-4-methyl-6-[(2R,3R)-4-methylidene-5-oxo-2-(2-oxopropyl)oxolan-3-yl]-5-oxohexoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162998570 |
| Molecular Formula | C23H34O11 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4R)-4-methyl-6-[(2R,3R)-4-methylidene-5-oxo-2-(2-oxopropyl)oxolan-3-yl]-5-oxohexoxy]oxan-2-yl]methyl acetate |
| SMILES | C=C1C(=O)O[C@H](CC(C)=O)[C@@H]1CC(=O)[C@H](C)CCCO[C@@H]1O[C@@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H34O11/c1-11(16(26)9-15-13(3)22(30)33-17(15)8-12(2)24)6-5-7-31-23-21(29)20(28)19(27)18(34-23)10-32-14(4)25/h11,15,17-21,23,27-29H,3,5-10H2,1-2,4H3/t11-,15-,17-,18+,19-,20+,21-,23-/m1/s1 |
| InChIKey | VPXNYABMLVFZMO-RSYPBGBYSA-N |
| XLogP | -0.17 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|