C17H26O4 — CID 162998932
[(1R,3aR,4R,8aS)-8a-hydroxy-3a,6-dimethyl-3-oxo-1-propan-2-yl-2,4,7,8-tetrahydro-1H-azulen-4-yl] acetate (PubChem CID 162998932) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(1R,3aR,4R,8aS)-8a-hydroxy-3a,6-dimethyl-3-oxo-1-propan-2-yl-2,4,7,8-tetrahydro-1H-azulen-4-yl] acetate.
| Compound Name | [(1R,3aR,4R,8aS)-8a-hydroxy-3a,6-dimethyl-3-oxo-1-propan-2-yl-2,4,7,8-tetrahydro-1H-azulen-4-yl] acetate |
|---|---|
| PubChem CID | 162998932 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(1R,3aR,4R,8aS)-8a-hydroxy-3a,6-dimethyl-3-oxo-1-propan-2-yl-2,4,7,8-tetrahydro-1H-azulen-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(C)CC[C@]2(O)[C@@H](C(C)C)CC(=O)[C@]12C |
| InChI | InChI=1S/C17H26O4/c1-10(2)13-9-14(19)16(5)15(21-12(4)18)8-11(3)6-7-17(13,16)20/h8,10,13,15,20H,6-7,9H2,1-5H3/t13-,15-,16-,17+/m1/s1 |
| InChIKey | NMFFRLYFDXSRFV-DZUCGIPZSA-N |
| XLogP | 2.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|