C34H38O6 — CID 162999462
1-[(1S,4R,5R,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-4-[(4-hydroxyphenyl)methyl]phenyl]phenyl]propan-1-one (PubChem CID 162999462) has the molecular formula C34H38O6 and a molecular weight of 542.67 g/mol. Its IUPAC name is 1-[(1S,4R,5R,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-4-[(4-hydroxyphenyl)methyl]phenyl]phenyl]propan-1-one.
| Compound Name | 1-[(1S,4R,5R,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-4-[(4-hydroxyphenyl)methyl]phenyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 162999462 |
| Molecular Formula | C34H38O6 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 1-[(1S,4R,5R,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-4-[(4-hydroxyphenyl)methyl]phenyl]phenyl]propan-1-one |
| SMILES | C=C1[C@H]2[C@H](CO)C[C@@](C(=O)CCc3cccc(-c4ccc(Cc5ccc(O)cc5)c(O)c4)c3)(C1(C)C)[C@]2(O)OC |
| InChI | InChI=1S/C34H38O6/c1-21-31-27(20-35)19-33(32(21,2)3,34(31,39)40-4)30(38)15-10-22-6-5-7-24(16-22)25-11-12-26(29(37)18-25)17-23-8-13-28(36)14-9-23/h5-9,11-14,16,18,27,31,35-37,39H,1,10,15,17,19-20H2,2-4H3/t27-,31-,33+,34+/m0/s1 |
| InChIKey | CRSJQTDWGPAMSH-HHYCOGPBSA-N |
| XLogP | 5.40 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|