C22H34O4 — CID 162999488
(3aS,5S,9aR)-1-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-5-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one (PubChem CID 162999488) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (3aS,5S,9aR)-1-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-5-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one.
| Compound Name | (3aS,5S,9aR)-1-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-5-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
|---|---|
| PubChem CID | 162999488 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (3aS,5S,9aR)-1-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-5-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
| SMILES | CO[C@H]1CCC(=O)C2=C1O[C@@]1(C)CC=C([C@H](C)CCC[C@H](C)CO)[C@H]1C2 |
| InChI | InChI=1S/C22H34O4/c1-14(13-23)6-5-7-15(2)16-10-11-22(3)18(16)12-17-19(24)8-9-20(25-4)21(17)26-22/h10,14-15,18,20,23H,5-9,11-13H2,1-4H3/t14-,15+,18+,20-,22-/m0/s1 |
| InChIKey | YQNSDWMPJRRXJM-PSKSFGTBSA-N |
| XLogP | 4.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|