C38H48N2O5 — CID 162999835
2-[[(1S)-2-[7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 162999835) has the molecular formula C38H48N2O5 and a molecular weight of 612.81 g/mol. Its IUPAC name is 2-[[(1S)-2-[7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1S)-2-[7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162999835 |
| Molecular Formula | C38H48N2O5 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.36 |
| IUPAC Name | 2-[[(1S)-2-[7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N1CCc2ccccc2[C@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C38H48N2O5/c1-2-3-6-14-29(41)22-20-28-21-23-35(42)31(28)16-7-4-5-8-19-36(43)39-25-24-27-13-9-10-15-30(27)34(39)26-40-37(44)32-17-11-12-18-33(32)38(40)45/h9-13,15,17-18,20,22,28-29,31,34,41H,2-8,14,16,19,21,23-26H2,1H3/t28-,29+,31-,34-/m1/s1 |
| InChIKey | OROYTMBXEOONAU-QPBRMJRSSA-N |
| XLogP | 6.84 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|