C20H16O6 — CID 162999941
(3R,11S,17S)-7,20-dihydroxy-17-prop-1-en-2-yl-10,12,16-trioxapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(13),4(9),5,7,14,19-hexaen-2-one (PubChem CID 162999941) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is (3R,11S,17S)-7,20-dihydroxy-17-prop-1-en-2-yl-10,12,16-trioxapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(13),4(9),5,7,14,19-hexaen-2-one.
| Compound Name | (3R,11S,17S)-7,20-dihydroxy-17-prop-1-en-2-yl-10,12,16-trioxapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(13),4(9),5,7,14,19-hexaen-2-one |
|---|---|
| PubChem CID | 162999941 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3R,11S,17S)-7,20-dihydroxy-17-prop-1-en-2-yl-10,12,16-trioxapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(13),4(9),5,7,14,19-hexaen-2-one |
| SMILES | C=C(C)[C@@H]1Cc2c(cc3c(c2O)C(=O)[C@@H]2c4ccc(O)cc4O[C@H]2O3)O1 |
| InChI | InChI=1S/C20H16O6/c1-8(2)12-6-11-14(24-12)7-15-17(18(11)22)19(23)16-10-4-3-9(21)5-13(10)25-20(16)26-15/h3-5,7,12,16,20-22H,1,6H2,2H3/t12-,16-,20-/m0/s1 |
| InChIKey | SNZADWQDGYHTOB-APXLUKDGSA-N |
| XLogP | 3.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|