C19H21NO5 — CID 163000507
(2S,3R,5S,6R)-3-hydroxy-5-[(1S)-1-hydroxyethyl]-2,5-dimethyl-11-phenyl-4,7-dioxa-9-azatricyclo[6.4.0.02,6]dodeca-1(8),10-dien-12-one (PubChem CID 163000507) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S,3R,5S,6R)-3-hydroxy-5-[(1S)-1-hydroxyethyl]-2,5-dimethyl-11-phenyl-4,7-dioxa-9-azatricyclo[6.4.0.02,6]dodeca-1(8),10-dien-12-one.
| Compound Name | (2S,3R,5S,6R)-3-hydroxy-5-[(1S)-1-hydroxyethyl]-2,5-dimethyl-11-phenyl-4,7-dioxa-9-azatricyclo[6.4.0.02,6]dodeca-1(8),10-dien-12-one |
|---|---|
| PubChem CID | 163000507 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2S,3R,5S,6R)-3-hydroxy-5-[(1S)-1-hydroxyethyl]-2,5-dimethyl-11-phenyl-4,7-dioxa-9-azatricyclo[6.4.0.02,6]dodeca-1(8),10-dien-12-one |
| SMILES | C[C@H](O)[C@]1(C)O[C@@H](O)[C@@]2(C)c3c([nH]cc(-c4ccccc4)c3=O)O[C@@H]12 |
| InChI | InChI=1S/C19H21NO5/c1-10(21)19(3)16-18(2,17(23)25-19)13-14(22)12(9-20-15(13)24-16)11-7-5-4-6-8-11/h4-10,16-17,21,23H,1-3H3,(H,20,22)/t10-,16+,17+,18-,19-/m0/s1 |
| InChIKey | HKJGXZQUAMKOKS-ZSBCPBHGSA-N |
| XLogP | 1.55 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |