C41H59NO8 — CID 163000530
4-methyl-2-(9,24,32-trihydroxy-10,13,19,20-tetramethyl-27-methylidene-33,34,35-trioxa-22-azahexacyclo[27.3.1.11,4.14,7.012,17.017,23]pentatriaconta-10,13,22-trien-14-yl)-2H-furan-5-one (PubChem CID 163000530) has the molecular formula C41H59NO8 and a molecular weight of 693.92 g/mol. Its IUPAC name is 4-methyl-2-(9,24,32-trihydroxy-10,13,19,20-tetramethyl-27-methylidene-33,34,35-trioxa-22-azahexacyclo[27.3.1.11,4.14,7.012,17.017,23]pentatriaconta-10,13,22-trien-14-yl)-2H-furan-5-one.
| Compound Name | 4-methyl-2-(9,24,32-trihydroxy-10,13,19,20-tetramethyl-27-methylidene-33,34,35-trioxa-22-azahexacyclo[27.3.1.11,4.14,7.012,17.017,23]pentatriaconta-10,13,22-trien-14-yl)-2H-furan-5-one |
|---|---|
| PubChem CID | 163000530 |
| Molecular Formula | C41H59NO8 |
| Molecular Weight | 693.92 g/mol |
| Exact Mass | 693.42 |
| IUPAC Name | 4-methyl-2-(9,24,32-trihydroxy-10,13,19,20-tetramethyl-27-methylidene-33,34,35-trioxa-22-azahexacyclo[27.3.1.11,4.14,7.012,17.017,23]pentatriaconta-10,13,22-trien-14-yl)-2H-furan-5-one |
| SMILES | C=C1CCC(O)C2=NCC(C)C(C)CC23CCC(C2C=C(C)C(=O)O2)=C(C)C3C=C(C)C(O)CC2CCC3(CCC4(OC(CCC4O)C1)O3)O2 |
| InChI | InChI=1S/C41H59NO8/c1-23-7-9-33(43)37-39(21-26(4)27(5)22-42-37)13-12-31(35-19-25(3)38(46)47-35)28(6)32(39)18-24(2)34(44)20-30-11-14-40(48-30)15-16-41(50-40)36(45)10-8-29(17-23)49-41/h18-19,26-27,29-30,32-36,43-45H,1,7-17,20-22H2,2-6H3 |
| InChIKey | YEBJLPZBBAZOPS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.92 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|