C13H8O — CID 163000767
(2R)-2-[(E)-undec-1-en-3,5,7,9-tetraynyl]oxirane (PubChem CID 163000767) has the molecular formula C13H8O and a molecular weight of 180.21 g/mol. Its IUPAC name is (2R)-2-[(E)-undec-1-en-3,5,7,9-tetraynyl]oxirane.
| Compound Name | (2R)-2-[(E)-undec-1-en-3,5,7,9-tetraynyl]oxirane |
|---|---|
| PubChem CID | 163000767 |
| Molecular Formula | C13H8O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2R)-2-[(E)-undec-1-en-3,5,7,9-tetraynyl]oxirane |
| SMILES | CC#CC#CC#CC#C/C=C/[C@@H]1CO1 |
| InChI | InChI=1S/C13H8O/c1-2-3-4-5-6-7-8-9-10-11-13-12-14-13/h10-11,13H,12H2,1H3/b11-10+/t13-/m1/s1 |
| InChIKey | YSBRTMBNHRGHRP-OCHBPSSRSA-N |
| XLogP | 0.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|