C36H54O8 — CID 163000804
dimethyl 2,3-diacetyloxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate (PubChem CID 163000804) has the molecular formula C36H54O8 and a molecular weight of 614.82 g/mol. Its IUPAC name is dimethyl 2,3-diacetyloxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate.
| Compound Name | dimethyl 2,3-diacetyloxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate |
|---|---|
| PubChem CID | 163000804 |
| Molecular Formula | C36H54O8 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | dimethyl 2,3-diacetyloxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate |
| SMILES | COC(=O)C12CCC(C)(C)CC1C1=CCC3C4(C)CC(OC(C)=O)C(OC(C)=O)C(C)(C(=O)OC)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C36H54O8/c1-21(37)43-25-20-32(5)26-12-11-23-24-19-31(3,4)15-17-36(24,30(40)42-10)18-16-33(23,6)34(26,7)14-13-27(32)35(8,29(39)41-9)28(25)44-22(2)38/h11,24-28H,12-20H2,1-10H3 |
| InChIKey | QIMIRBUPDQBHAU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|