C31H50O2 — CID 163001545
methyl (1R,3S,5S,8R,9S,10S,13S,14S,17S)-4,4,8,10,13,14-hexamethyl-1,17-bis(prop-1-en-2-yl)-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 163001545) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is methyl (1R,3S,5S,8R,9S,10S,13S,14S,17S)-4,4,8,10,13,14-hexamethyl-1,17-bis(prop-1-en-2-yl)-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (1R,3S,5S,8R,9S,10S,13S,14S,17S)-4,4,8,10,13,14-hexamethyl-1,17-bis(prop-1-en-2-yl)-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 163001545 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | methyl (1R,3S,5S,8R,9S,10S,13S,14S,17S)-4,4,8,10,13,14-hexamethyl-1,17-bis(prop-1-en-2-yl)-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | C=C(C)[C@H]1C[C@H](C(=O)OC)C(C)(C)[C@@H]2CC[C@]3(C)[C@@H](CC[C@@]4(C)[C@H](C(=C)C)CC[C@@]43C)[C@@]12C |
| InChI | InChI=1S/C31H50O2/c1-19(2)21-12-17-30(9)28(21,7)15-14-25-29(30,8)16-13-24-27(5,6)23(26(32)33-11)18-22(20(3)4)31(24,25)10/h21-25H,1,3,12-18H2,2,4-11H3/t21-,22+,23+,24-,25+,28-,29+,30-,31-/m0/s1 |
| InChIKey | DLUHNQYRSRXMIN-WWYSUMRESA-N |
| XLogP | 8.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|