C22H36O — CID 163002078
(3E,5E,7R,10E)-7-ethoxy-3,7,11,15-tetramethylhexadeca-1,3,5,10,14-pentaene (PubChem CID 163002078) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is (3E,5E,7R,10E)-7-ethoxy-3,7,11,15-tetramethylhexadeca-1,3,5,10,14-pentaene.
| Compound Name | (3E,5E,7R,10E)-7-ethoxy-3,7,11,15-tetramethylhexadeca-1,3,5,10,14-pentaene |
|---|---|
| PubChem CID | 163002078 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | (3E,5E,7R,10E)-7-ethoxy-3,7,11,15-tetramethylhexadeca-1,3,5,10,14-pentaene |
| SMILES | C=C/C(C)=C/C=C/[C@@](C)(CC/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C22H36O/c1-8-20(5)15-11-17-22(7,23-9-2)18-12-16-21(6)14-10-13-19(3)4/h8,11,13,15-17H,1,9-10,12,14,18H2,2-7H3/b17-11+,20-15+,21-16+/t22-/m0/s1 |
| InChIKey | WVIIOGQLYAWFLP-SPQKUPAHSA-N |
| XLogP | 6.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|