C26H32O8 — CID 163002103
1-[2,4-dihydroxy-3-(5-hydroxy-5-methyl-2-prop-1-en-2-ylhexyl)-6-methoxyphenyl]-3-(2,4-dihydroxyphenyl)-2-hydroxyprop-2-en-1-one (PubChem CID 163002103) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is 1-[2,4-dihydroxy-3-(5-hydroxy-5-methyl-2-prop-1-en-2-ylhexyl)-6-methoxyphenyl]-3-(2,4-dihydroxyphenyl)-2-hydroxyprop-2-en-1-one.
| Compound Name | 1-[2,4-dihydroxy-3-(5-hydroxy-5-methyl-2-prop-1-en-2-ylhexyl)-6-methoxyphenyl]-3-(2,4-dihydroxyphenyl)-2-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 163002103 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1-[2,4-dihydroxy-3-(5-hydroxy-5-methyl-2-prop-1-en-2-ylhexyl)-6-methoxyphenyl]-3-(2,4-dihydroxyphenyl)-2-hydroxyprop-2-en-1-one |
| SMILES | C=C(C)C(CCC(C)(C)O)Cc1c(O)cc(OC)c(C(=O)C(O)=Cc2ccc(O)cc2O)c1O |
| InChI | InChI=1S/C26H32O8/c1-14(2)15(8-9-26(3,4)33)10-18-20(29)13-22(34-5)23(24(18)31)25(32)21(30)11-16-6-7-17(27)12-19(16)28/h6-7,11-13,15,27-31,33H,1,8-10H2,2-5H3 |
| InChIKey | WIZTTYONBFRXCA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|