C30H48O3 — CID 163002147
(1S,2R,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-5-carboxylic acid (PubChem CID 163002147) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (1S,2R,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-5-carboxylic acid.
| Compound Name | (1S,2R,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-5-carboxylic acid |
|---|---|
| PubChem CID | 163002147 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (1S,2R,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-5-carboxylic acid |
| SMILES | C[C@@H]1[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H](C(=O)O)[C@@H]2CC[C@H]1C |
| InChI | InChI=1S/C30H48O3/c1-17-8-9-19-20(26(32)33)16-30(7)21(25(19)18(17)2)10-11-23-28(5)14-13-24(31)27(3,4)22(28)12-15-29(23,30)6/h10,17-20,22-25,31H,8-9,11-16H2,1-7H3,(H,32,33)/t17-,18+,19+,20+,22+,23-,24+,25-,28+,29-,30-/m1/s1 |
| InChIKey | MGOSOJYXPFWQRF-DIDRIAFMSA-N |
| XLogP | 6.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|