C19H26O6 — CID 163002487
2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one (PubChem CID 163002487) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one.
| Compound Name | 2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one |
|---|---|
| PubChem CID | 163002487 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one |
| SMILES | CC1CCC2OC(=O)C3(CO)CC4OC35CC2(O)C1(C)C=C5C4(C)O |
| InChI | InChI=1S/C19H26O6/c1-10-4-5-12-18(23)8-19-11(6-15(10,18)2)16(3,22)13(25-19)7-17(19,9-20)14(21)24-12/h6,10,12-13,20,22-23H,4-5,7-9H2,1-3H3 |
| InChIKey | GWMKYPYHYJQGBX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|