C18H24O5 — CID 163003404
methyl (1E,3S,5Z,8E)-3-acetyloxy-4,4,8-trimethyl-7-oxocycloundeca-1,5,8-triene-1-carboxylate (PubChem CID 163003404) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (1E,3S,5Z,8E)-3-acetyloxy-4,4,8-trimethyl-7-oxocycloundeca-1,5,8-triene-1-carboxylate.
| Compound Name | methyl (1E,3S,5Z,8E)-3-acetyloxy-4,4,8-trimethyl-7-oxocycloundeca-1,5,8-triene-1-carboxylate |
|---|---|
| PubChem CID | 163003404 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl (1E,3S,5Z,8E)-3-acetyloxy-4,4,8-trimethyl-7-oxocycloundeca-1,5,8-triene-1-carboxylate |
| SMILES | COC(=O)/C1=C/[C@H](OC(C)=O)C(C)(C)/C=C\C(=O)/C(C)=C/CC1 |
| InChI | InChI=1S/C18H24O5/c1-12-7-6-8-14(17(21)22-5)11-16(23-13(2)19)18(3,4)10-9-15(12)20/h7,9-11,16H,6,8H2,1-5H3/b10-9-,12-7+,14-11+/t16-/m0/s1 |
| InChIKey | CLNDAYOHEVNSFF-PDHMXIOZSA-N |
| XLogP | 2.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |