C10H14O4 — CID 163003585
6-[(2R,3S)-3-hydroxybutan-2-yl]-4-methoxypyran-2-one (PubChem CID 163003585) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 6-[(2R,3S)-3-hydroxybutan-2-yl]-4-methoxypyran-2-one.
| Compound Name | 6-[(2R,3S)-3-hydroxybutan-2-yl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 163003585 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-[(2R,3S)-3-hydroxybutan-2-yl]-4-methoxypyran-2-one |
| SMILES | COc1cc([C@H](C)[C@H](C)O)oc(=O)c1 |
| InChI | InChI=1S/C10H14O4/c1-6(7(2)11)9-4-8(13-3)5-10(12)14-9/h4-7,11H,1-3H3/t6-,7+/m1/s1 |
| InChIKey | YHUYXKZLGRZKAJ-RQJHMYQMSA-N |
| XLogP | 1.13 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |