C34H50N2O3 — CID 163003601
4-[[15-[1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-9-enyl]-methylamino]benzaldehyde (PubChem CID 163003601) has the molecular formula C34H50N2O3 and a molecular weight of 534.79 g/mol. Its IUPAC name is 4-[[15-[1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-9-enyl]-methylamino]benzaldehyde.
| Compound Name | 4-[[15-[1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-9-enyl]-methylamino]benzaldehyde |
|---|---|
| PubChem CID | 163003601 |
| Molecular Formula | C34H50N2O3 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | 4-[[15-[1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-9-enyl]-methylamino]benzaldehyde |
| SMILES | CC(C1C(O)CC2(C)C3C=CC4C(C)(CO)C(N(C)c5ccc(C=O)cc5)CCC45CC35CCC12C)N(C)C |
| InChI | InChI=1S/C34H50N2O3/c1-22(35(5)6)29-25(39)18-32(4)27-13-12-26-30(2,21-38)28(36(7)24-10-8-23(19-37)9-11-24)14-15-33(26)20-34(27,33)17-16-31(29,32)3/h8-13,19,22,25-29,38-39H,14-18,20-21H2,1-7H3 |
| InChIKey | OFNBVFWCDZDEJX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|