C25H18Cl2O5 — CID 163003655
ethyl (2S)-2-[[2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-2-phenylacetate (PubChem CID 163003655) has the molecular formula C25H18Cl2O5 and a molecular weight of 469.32 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[[2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-2-phenylacetate |
|---|---|
| PubChem CID | 163003655 |
| Molecular Formula | C25H18Cl2O5 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | ethyl (2S)-2-[[2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](Oc1ccc2c(c1)OC(=Cc1c(Cl)cccc1Cl)C2=O)c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2O5/c1-2-30-25(29)24(15-7-4-3-5-8-15)31-16-11-12-17-21(13-16)32-22(23(17)28)14-18-19(26)9-6-10-20(18)27/h3-14,24H,2H2,1H3/t24-/m0/s1 |
| InChIKey | WKKYSLTXJZSPGR-DEOSSOPVSA-N |
| XLogP | 6.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|