C27H42O2 — CID 163003758
(4S,5S)-4-hydroxy-3-methyl-5-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]cyclohex-2-en-1-one (PubChem CID 163003758) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (4S,5S)-4-hydroxy-3-methyl-5-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]cyclohex-2-en-1-one.
| Compound Name | (4S,5S)-4-hydroxy-3-methyl-5-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163003758 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (4S,5S)-4-hydroxy-3-methyl-5-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]cyclohex-2-en-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C[C@H]1CC(=O)C=C(C)[C@H]1O |
| InChI | InChI=1S/C27H42O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-15-23(5)16-17-25-19-26(28)18-24(6)27(25)29/h10,12,14,16,18,25,27,29H,7-9,11,13,15,17,19H2,1-6H3/b21-12+,22-14+,23-16+/t25-,27+/m0/s1 |
| InChIKey | HOMSLHHQMMWTPW-TWXQUNJUSA-N |
| XLogP | 7.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|