About (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran
(2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran (PubChem CID 163003859) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran.
Molecular Properties
| Compound Name | (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran |
| PubChem CID | 163003859 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran |
| SMILES | C=C[C@@]1(C)CC=CC(C)(C)O1 |
| InChI | InChI=1S/C10H16O/c1-5-10(4)8-6-7-9(2,3)11-10/h5-7H,1,8H2,2-4H3/t10-/m0/s1 |
| InChIKey | XFDJWESOIHLOCV-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran?
The IUPAC name of (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran (CID 163003859) is (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran.
What is the SMILES notation for (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran?
The canonical SMILES for (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran is C=C[C@@]1(C)CC=CC(C)(C)O1.
What is the InChIKey of (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran?
The InChIKey is XFDJWESOIHLOCV-JTQLQIEISA-N. The full InChI is InChI=1S/C10H16O/c1-5-10(4)8-6-7-9(2,3)11-10/h5-7H,1,8H2,2-4H3/t10-/m0/s1.
What are the key properties of (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran?
(2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran has a molecular weight of 152.24 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethenyl-2,6,6-trimethyl-3H-pyran is sourced from PubChem (CID 163003859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).