C20H30O — CID 163004117
(2R,3E)-2-[(1R,4R,5S,6R,7R)-4,10-dimethyl-7-tricyclo[4.4.0.01,5]dec-9-enyl]-6-methylhepta-3,5-dien-2-ol (PubChem CID 163004117) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (2R,3E)-2-[(1R,4R,5S,6R,7R)-4,10-dimethyl-7-tricyclo[4.4.0.01,5]dec-9-enyl]-6-methylhepta-3,5-dien-2-ol.
| Compound Name | (2R,3E)-2-[(1R,4R,5S,6R,7R)-4,10-dimethyl-7-tricyclo[4.4.0.01,5]dec-9-enyl]-6-methylhepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 163004117 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2R,3E)-2-[(1R,4R,5S,6R,7R)-4,10-dimethyl-7-tricyclo[4.4.0.01,5]dec-9-enyl]-6-methylhepta-3,5-dien-2-ol |
| SMILES | CC(C)=C/C=C/[C@@](C)(O)[C@@H]1CC=C(C)[C@]23CC[C@@H](C)[C@H]2[C@H]13 |
| InChI | InChI=1S/C20H30O/c1-13(2)7-6-11-19(5,21)16-9-8-15(4)20-12-10-14(3)17(20)18(16)20/h6-8,11,14,16-18,21H,9-10,12H2,1-5H3/b11-6+/t14-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | RTLBATILCLJLNX-QCIQFDQOSA-N |
| XLogP | 4.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|