About 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol
4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol (PubChem CID 163004264) has the molecular formula C16H20O
and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol.
Molecular Properties
| Compound Name | 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol |
| PubChem CID | 163004264 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol |
| SMILES | C=CC(C)(C)C(=Cc1ccc(O)cc1)C(=C)C |
| InChI | InChI=1S/C16H20O/c1-6-16(4,5)15(12(2)3)11-13-7-9-14(17)10-8-13/h6-11,17H,1-2H2,3-5H3 |
| InChIKey | PKUFKRZKPOCIRZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol?
The IUPAC name of 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol (CID 163004264) is 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol.
What is the SMILES notation for 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol?
The canonical SMILES for 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol is C=CC(C)(C)C(=Cc1ccc(O)cc1)C(=C)C.
What is the InChIKey of 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol?
The InChIKey is PKUFKRZKPOCIRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O/c1-6-16(4,5)15(12(2)3)11-13-7-9-14(17)10-8-13/h6-11,17H,1-2H2,3-5H3.
What are the key properties of 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol?
4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol has a molecular weight of 228.33 g/mol, XLogP of 4.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethyl-2-prop-1-en-2-ylpenta-1,4-dienyl)phenol is sourced from PubChem (CID 163004264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).