C12H20O6 — CID 163004340
propan-2-yl 4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylate (PubChem CID 163004340) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is propan-2-yl 4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylate.
| Compound Name | propan-2-yl 4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 163004340 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | propan-2-yl 4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylate |
| SMILES | COC1OC(C(=O)OC(C)C)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H20O6/c1-6(2)15-10(13)8-7-9(11(14-5)16-8)18-12(3,4)17-7/h6-9,11H,1-5H3 |
| InChIKey | PBWLNPLKIBIPBU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |