C27H39NO5 — CID 163004597
[(1S,2S,10R,11S,12R,13S,15S)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl] 3-(2,6-dimethoxyphenyl)propanoate (PubChem CID 163004597) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is [(1S,2S,10R,11S,12R,13S,15S)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl] 3-(2,6-dimethoxyphenyl)propanoate.
| Compound Name | [(1S,2S,10R,11S,12R,13S,15S)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl] 3-(2,6-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 163004597 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | [(1S,2S,10R,11S,12R,13S,15S)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl] 3-(2,6-dimethoxyphenyl)propanoate |
| SMILES | COc1cccc(OC)c1CCC(=O)O[C@@H]1[C@H](O)[C@H]2C[C@H](C)C[C@@]34[C@H]2CCCN3CCC[C@@H]14 |
| InChI | InChI=1S/C27H39NO5/c1-17-15-19-20-7-5-13-28-14-6-8-21(27(20,28)16-17)26(25(19)30)33-24(29)12-11-18-22(31-2)9-4-10-23(18)32-3/h4,9-10,17,19-21,25-26,30H,5-8,11-16H2,1-3H3/t17-,19-,20-,21-,25+,26-,27-/m0/s1 |
| InChIKey | PCJKAEVVAJPRDT-OIACPBLLSA-N |
| XLogP | 3.83 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |