C22H30O6 — CID 163004723
[4-acetyloxy-3-(acetyloxymethylidene)-4,7,11-trimethyldodeca-1,6-dien-8-ynyl] acetate (PubChem CID 163004723) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [4-acetyloxy-3-(acetyloxymethylidene)-4,7,11-trimethyldodeca-1,6-dien-8-ynyl] acetate.
| Compound Name | [4-acetyloxy-3-(acetyloxymethylidene)-4,7,11-trimethyldodeca-1,6-dien-8-ynyl] acetate |
|---|---|
| PubChem CID | 163004723 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [4-acetyloxy-3-(acetyloxymethylidene)-4,7,11-trimethyldodeca-1,6-dien-8-ynyl] acetate |
| SMILES | CC(=O)OC=CC(=COC(C)=O)C(C)(CC=C(C)C#CCC(C)C)OC(C)=O |
| InChI | InChI=1S/C22H30O6/c1-16(2)9-8-10-17(3)11-13-22(7,28-20(6)25)21(15-27-19(5)24)12-14-26-18(4)23/h11-12,14-16H,9,13H2,1-7H3 |
| InChIKey | MHQRAJZYDRZVOC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|