C23H24O11 — CID 163004933
5-hydroxy-6,7-dimethoxy-3-[4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one (PubChem CID 163004933) has the molecular formula C23H24O11 and a molecular weight of 476.43 g/mol. Its IUPAC name is 5-hydroxy-6,7-dimethoxy-3-[4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one.
| Compound Name | 5-hydroxy-6,7-dimethoxy-3-[4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
|---|---|
| PubChem CID | 163004933 |
| Molecular Formula | C23H24O11 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5-hydroxy-6,7-dimethoxy-3-[4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
| SMILES | COc1cc2occ(-c3ccc(O[C@H]4O[C@@H](CO)[C@H](O)[C@@H](O)[C@H]4O)cc3)c(=O)c2c(O)c1OC |
| InChI | InChI=1S/C23H24O11/c1-30-14-7-13-16(19(27)22(14)31-2)17(25)12(9-32-13)10-3-5-11(6-4-10)33-23-21(29)20(28)18(26)15(8-24)34-23/h3-7,9,15,18,20-21,23-24,26-29H,8H2,1-2H3/t15-,18-,20+,21+,23-/m0/s1 |
| InChIKey | YIOGKKRAFIMIAE-SSMZIKIMSA-N |
| XLogP | 0.36 |
| TPSA | 168.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |