C33H56O — CID 163005229
(2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]oxirane (PubChem CID 163005229) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol. Its IUPAC name is (2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]oxirane.
| Compound Name | (2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]oxirane |
|---|---|
| PubChem CID | 163005229 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | (2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]oxirane |
| SMILES | C=C(CC[C@H](C)C(=C)C)[C@H](C)CC/C(C)=C/CC[C@H]1O[C@]1(C)CC[C@@H](C)C(=C)CCC=C(C)C |
| InChI | InChI=1S/C33H56O/c1-24(2)14-12-16-28(7)31(10)22-23-33(11)32(34-33)17-13-15-26(5)18-19-29(8)30(9)21-20-27(6)25(3)4/h14-15,27,29,31-32H,3,7,9,12-13,16-23H2,1-2,4-6,8,10-11H3/b26-15+/t27-,29+,31+,32+,33+/m0/s1 |
| InChIKey | JSPACWYLVPDIEH-HMSITGBPSA-N |
| XLogP | 10.55 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|