About (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile
(3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile (PubChem CID 163005368) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile.
Molecular Properties
| Compound Name | (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile |
| PubChem CID | 163005368 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile |
| SMILES | N#CCCOc1ccc([C@@H](O)[C@H](O)CC#N)cc1 |
| InChI | InChI=1S/C13H14N2O3/c14-7-1-9-18-11-4-2-10(3-5-11)13(17)12(16)6-8-15/h2-5,12-13,16-17H,1,6,9H2/t12-,13-/m1/s1 |
| InChIKey | JYKAXUOTCMVBDT-CHWSQXEVSA-N |
| XLogP | 1.29 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile?
The IUPAC name of (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile (CID 163005368) is (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile.
What is the SMILES notation for (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile?
The canonical SMILES for (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile is N#CCCOc1ccc([C@@H](O)[C@H](O)CC#N)cc1.
What is the InChIKey of (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile?
The InChIKey is JYKAXUOTCMVBDT-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H14N2O3/c14-7-1-9-18-11-4-2-10(3-5-11)13(17)12(16)6-8-15/h2-5,12-13,16-17H,1,6,9H2/t12-,13-/m1/s1.
What are the key properties of (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile?
(3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile has a molecular weight of 246.27 g/mol, XLogP of 1.29, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-[4-(2-cyanoethoxy)phenyl]-3,4-dihydroxybutanenitrile is sourced from PubChem (CID 163005368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).