C12H18O3 — CID 163005387
(5S,6R)-6-but-2-en-2-yl-3,3,5-trimethyloxane-2,4-dione (PubChem CID 163005387) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (5S,6R)-6-but-2-en-2-yl-3,3,5-trimethyloxane-2,4-dione.
| Compound Name | (5S,6R)-6-but-2-en-2-yl-3,3,5-trimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 163005387 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (5S,6R)-6-but-2-en-2-yl-3,3,5-trimethyloxane-2,4-dione |
| SMILES | CC=C(C)[C@@H]1OC(=O)C(C)(C)C(=O)[C@H]1C |
| InChI | InChI=1S/C12H18O3/c1-6-7(2)9-8(3)10(13)12(4,5)11(14)15-9/h6,8-9H,1-5H3/t8-,9-/m0/s1 |
| InChIKey | FCTVAZHNKONSMQ-IUCAKERBSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|