C25H48 — CID 163005396
(E,7S,10S)-2,6,10,14-tetramethyl-7-[(3R)-3-methylpent-4-enyl]pentadec-5-ene (PubChem CID 163005396) has the molecular formula C25H48 and a molecular weight of 348.66 g/mol. Its IUPAC name is (E,7S,10S)-2,6,10,14-tetramethyl-7-[(3R)-3-methylpent-4-enyl]pentadec-5-ene.
| Compound Name | (E,7S,10S)-2,6,10,14-tetramethyl-7-[(3R)-3-methylpent-4-enyl]pentadec-5-ene |
|---|---|
| PubChem CID | 163005396 |
| Molecular Formula | C25H48 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 348.38 |
| IUPAC Name | (E,7S,10S)-2,6,10,14-tetramethyl-7-[(3R)-3-methylpent-4-enyl]pentadec-5-ene |
| SMILES | C=C[C@H](C)CC[C@H](CC[C@@H](C)CCCC(C)C)/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C25H48/c1-9-22(6)16-18-25(24(8)15-11-13-21(4)5)19-17-23(7)14-10-12-20(2)3/h9,15,20-23,25H,1,10-14,16-19H2,2-8H3/b24-15+/t22-,23-,25+/m0/s1 |
| InChIKey | YJQZREBAXWNCAX-QZDZOKHOSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|