About methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate
methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate (PubChem CID 163005406) has the molecular formula C19H28O4
and a molecular weight of 320.43 g/mol. Its IUPAC name is methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate.
Molecular Properties
| Compound Name | methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate |
| PubChem CID | 163005406 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate |
| SMILES | CC/C=C/C=C1\C(=O)C=C[C@@]1(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H28O4/c1-3-4-8-11-16-17(20)13-15-19(16,22)14-10-7-5-6-9-12-18(21)23-2/h4,8,11,13,15,22H,3,5-7,9-10,12,14H2,1-2H3/b8-4+,16-11+/t19-/m0/s1 |
| InChIKey | CSKWXYDNGLJFQE-HFRWRIIYSA-N |
| XLogP | 3.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate?
The IUPAC name of methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate (CID 163005406) is methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate.
What is the SMILES notation for methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate?
The canonical SMILES for methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate is CC/C=C/C=C1\C(=O)C=C[C@@]1(O)CCCCCCCC(=O)OC.
What is the InChIKey of methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate?
The InChIKey is CSKWXYDNGLJFQE-HFRWRIIYSA-N. The full InChI is InChI=1S/C19H28O4/c1-3-4-8-11-16-17(20)13-15-19(16,22)14-10-7-5-6-9-12-18(21)23-2/h4,8,11,13,15,22H,3,5-7,9-10,12,14H2,1-2H3/b8-4+,16-11+/t19-/m0/s1.
What are the key properties of methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate?
methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate has a molecular weight of 320.43 g/mol, XLogP of 3.65, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(1S,5Z)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate is sourced from PubChem (CID 163005406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).