C36H50O17 — CID 163005500
(4,7,9,11,12,13-hexaacetyloxy-10-hydroxy-2,6,14,14-tetramethyl-3-oxo-16-oxatetracyclo[8.6.1.01,15.04,8]heptadecan-6-yl) 2-methylpropanoate (PubChem CID 163005500) has the molecular formula C36H50O17 and a molecular weight of 754.78 g/mol. Its IUPAC name is (4,7,9,11,12,13-hexaacetyloxy-10-hydroxy-2,6,14,14-tetramethyl-3-oxo-16-oxatetracyclo[8.6.1.01,15.04,8]heptadecan-6-yl) 2-methylpropanoate.
| Compound Name | (4,7,9,11,12,13-hexaacetyloxy-10-hydroxy-2,6,14,14-tetramethyl-3-oxo-16-oxatetracyclo[8.6.1.01,15.04,8]heptadecan-6-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 163005500 |
| Molecular Formula | C36H50O17 |
| Molecular Weight | 754.78 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | (4,7,9,11,12,13-hexaacetyloxy-10-hydroxy-2,6,14,14-tetramethyl-3-oxo-16-oxatetracyclo[8.6.1.01,15.04,8]heptadecan-6-yl) 2-methylpropanoate |
| SMILES | CC(=O)OC1C(OC(C)=O)C(C)(C)C2OC23CC(O)(C1OC(C)=O)C(OC(C)=O)C1C(OC(C)=O)C(C)(OC(=O)C(C)C)CC1(OC(C)=O)C(=O)C3C |
| InChI | InChI=1S/C36H50O17/c1-15(2)30(44)52-33(12)13-36(51-22(9)42)23(26(33)47-18(5)38)27(48-19(6)39)34(45)14-35(16(3)25(36)43)31(53-35)32(10,11)28(49-20(7)40)24(46-17(4)37)29(34)50-21(8)41/h15-16,23-24,26-29,31,45H,13-14H2,1-12H3 |
| InChIKey | CCODQELMBJQZIT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 233.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.78 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|