C30H50O — CID 163005813
(1S,2S,5R,6R,9S,10S,13R,15R)-2,5,9,14,14-pentamethyl-6-[(2S)-6-methylhept-5-en-2-yl]-18-oxapentacyclo[13.2.1.01,13.02,10.05,9]octadecane (PubChem CID 163005813) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10S,13R,15R)-2,5,9,14,14-pentamethyl-6-[(2S)-6-methylhept-5-en-2-yl]-18-oxapentacyclo[13.2.1.01,13.02,10.05,9]octadecane.
| Compound Name | (1S,2S,5R,6R,9S,10S,13R,15R)-2,5,9,14,14-pentamethyl-6-[(2S)-6-methylhept-5-en-2-yl]-18-oxapentacyclo[13.2.1.01,13.02,10.05,9]octadecane |
|---|---|
| PubChem CID | 163005813 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (1S,2S,5R,6R,9S,10S,13R,15R)-2,5,9,14,14-pentamethyl-6-[(2S)-6-methylhept-5-en-2-yl]-18-oxapentacyclo[13.2.1.01,13.02,10.05,9]octadecane |
| SMILES | CC(C)=CCC[C@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@@H]4C(C)(C)[C@H]5CC[C@@]4(O5)[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-16-28(7)24-13-12-23-26(4,5)25-15-17-30(23,31-25)29(24,8)19-18-27(22,28)6/h10,21-25H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25+,27+,28-,29-,30-/m0/s1 |
| InChIKey | LZHZZTPPPASAGI-YNCIHMFZSA-N |
| XLogP | 8.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|