C37H54O11 — CID 163005960
[2-[[17-(2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl)-2-hydroxy-4,4,9,13,14-pentamethyl-3-oxo-7,8,10,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 163005960) has the molecular formula C37H54O11 and a molecular weight of 674.83 g/mol. Its IUPAC name is [2-[[17-(2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl)-2-hydroxy-4,4,9,13,14-pentamethyl-3-oxo-7,8,10,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [2-[[17-(2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl)-2-hydroxy-4,4,9,13,14-pentamethyl-3-oxo-7,8,10,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 163005960 |
| Molecular Formula | C37H54O11 |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | [2-[[17-(2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl)-2-hydroxy-4,4,9,13,14-pentamethyl-3-oxo-7,8,10,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC2CC3(C)C4CC=C5C(C=C(O)C(=O)C5(C)C)C4(C)CCC3(C)C2C(C)(O)C(=O)C=CC(C)(C)O)OCC(O)C1O |
| InChI | InChI=1S/C37H54O11/c1-19(38)47-28-27(42)23(40)18-46-31(28)48-24-17-36(8)25-11-10-20-21(16-22(39)30(43)33(20,4)5)34(25,6)14-15-35(36,7)29(24)37(9,45)26(41)12-13-32(2,3)44/h10,12-13,16,21,23-25,27-29,31,39-40,42,44-45H,11,14-15,17-18H2,1-9H3 |
| InChIKey | UMUGPJUWSBVZGS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|