C22H30O6 — CID 163007418
(8-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) 2-methylbut-2-enoate (PubChem CID 163007418) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (8-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) 2-methylbut-2-enoate.
| Compound Name | (8-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163007418 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (8-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C=C(C)CC(OC(C)=O)CC(C)C(OC(=O)C(C)=CC)CC12 |
| InChI | InChI=1S/C22H30O6/c1-7-13(3)21(24)27-19-11-18-15(5)22(25)28-20(18)9-12(2)8-17(10-14(19)4)26-16(6)23/h7,9,14,17-20H,5,8,10-11H2,1-4,6H3 |
| InChIKey | WSSVORXENXPTNU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|