C10H14O4 — CID 163007523
3-[(1S,2S)-1,2-dihydroxy-4-methylpent-3-enyl]-2H-furan-5-one (PubChem CID 163007523) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-[(1S,2S)-1,2-dihydroxy-4-methylpent-3-enyl]-2H-furan-5-one.
| Compound Name | 3-[(1S,2S)-1,2-dihydroxy-4-methylpent-3-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 163007523 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-[(1S,2S)-1,2-dihydroxy-4-methylpent-3-enyl]-2H-furan-5-one |
| SMILES | CC(C)=C[C@H](O)[C@@H](O)C1=CC(=O)OC1 |
| InChI | InChI=1S/C10H14O4/c1-6(2)3-8(11)10(13)7-4-9(12)14-5-7/h3-4,8,10-11,13H,5H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | SQPJPMMCBPDNJN-WPRPVWTQSA-N |
| XLogP | 0.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|