C39H44N2O5 — CID 163008372
2,5-dihydroxy-3-(3-methylbut-2-enyl)-6-[2-[8-methyl-3-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]-2,5-dioxo-1-azaspiro[5.5]undec-9-en-11-yl]ethyl]benzaldehyde (PubChem CID 163008372) has the molecular formula C39H44N2O5 and a molecular weight of 620.79 g/mol. Its IUPAC name is 2,5-dihydroxy-3-(3-methylbut-2-enyl)-6-[2-[8-methyl-3-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]-2,5-dioxo-1-azaspiro[5.5]undec-9-en-11-yl]ethyl]benzaldehyde.
| Compound Name | 2,5-dihydroxy-3-(3-methylbut-2-enyl)-6-[2-[8-methyl-3-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]-2,5-dioxo-1-azaspiro[5.5]undec-9-en-11-yl]ethyl]benzaldehyde |
|---|---|
| PubChem CID | 163008372 |
| Molecular Formula | C39H44N2O5 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | 2,5-dihydroxy-3-(3-methylbut-2-enyl)-6-[2-[8-methyl-3-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]-2,5-dioxo-1-azaspiro[5.5]undec-9-en-11-yl]ethyl]benzaldehyde |
| SMILES | C=CC(C)(C)c1[nH]c2ccccc2c1C=C1CC(=O)C2(CC(C)C=CC2CCc2c(O)cc(CC=C(C)C)c(O)c2C=O)NC1=O |
| InChI | InChI=1S/C39H44N2O5/c1-7-38(5,6)36-30(28-10-8-9-11-32(28)40-36)18-26-20-34(44)39(41-37(26)46)21-24(4)13-15-27(39)16-17-29-31(22-42)35(45)25(19-33(29)43)14-12-23(2)3/h7-13,15,18-19,22,24,27,40,43,45H,1,14,16-17,20-21H2,2-6H3,(H,41,46) |
| InChIKey | LZHZJOFIQUCCEO-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|