C20H32O2 — CID 163008483
(1R,4R,6S,8S,11E,15R)-1,8,12-trimethyl-4-prop-1-en-2-yl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-11-ene (PubChem CID 163008483) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,4R,6S,8S,11E,15R)-1,8,12-trimethyl-4-prop-1-en-2-yl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-11-ene.
| Compound Name | (1R,4R,6S,8S,11E,15R)-1,8,12-trimethyl-4-prop-1-en-2-yl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-11-ene |
|---|---|
| PubChem CID | 163008483 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,4R,6S,8S,11E,15R)-1,8,12-trimethyl-4-prop-1-en-2-yl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-11-ene |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)O[C@@H]2CC/C(C)=C/CC[C@]2(C)O[C@H]2C1 |
| InChI | InChI=1S/C20H32O2/c1-14(2)16-10-12-20(5)17(21-20)9-8-15(3)7-6-11-19(4)18(13-16)22-19/h7,16-18H,1,6,8-13H2,2-5H3/b15-7+/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | NPKDOBIAPZDTFU-NWOJSZOLSA-N |
| XLogP | 5.18 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|