C15H26O3 — CID 163009127
(2S,6E,9R)-9-(hydroxymethyl)-2,6,10-trimethylundeca-6,10-dienoic acid (PubChem CID 163009127) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2S,6E,9R)-9-(hydroxymethyl)-2,6,10-trimethylundeca-6,10-dienoic acid.
| Compound Name | (2S,6E,9R)-9-(hydroxymethyl)-2,6,10-trimethylundeca-6,10-dienoic acid |
|---|---|
| PubChem CID | 163009127 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2S,6E,9R)-9-(hydroxymethyl)-2,6,10-trimethylundeca-6,10-dienoic acid |
| SMILES | C=C(C)[C@H](CO)C/C=C(\C)CCC[C@H](C)C(=O)O |
| InChI | InChI=1S/C15H26O3/c1-11(2)14(10-16)9-8-12(3)6-5-7-13(4)15(17)18/h8,13-14,16H,1,5-7,9-10H2,2-4H3,(H,17,18)/b12-8+/t13-,14-/m0/s1 |
| InChIKey | GRLWJUVQYWFKEO-QZKSUSQMSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|