C20H24O5 — CID 163009200
(3E,3aR,5S,8bS)-5,8,8-trimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one (PubChem CID 163009200) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3E,3aR,5S,8bS)-5,8,8-trimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one.
| Compound Name | (3E,3aR,5S,8bS)-5,8,8-trimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 163009200 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3E,3aR,5S,8bS)-5,8,8-trimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
| SMILES | CC1=C[C@H](O/C=C2/C(=O)O[C@@H]3C4=C(C[C@H]23)[C@@H](C)CCC4(C)C)OC1=O |
| InChI | InChI=1S/C20H24O5/c1-10-5-6-20(3,4)16-12(10)8-13-14(19(22)25-17(13)16)9-23-15-7-11(2)18(21)24-15/h7,9-10,13,15,17H,5-6,8H2,1-4H3/b14-9+/t10-,13+,15+,17-/m0/s1 |
| InChIKey | KEOQXENEHBJOJF-ABYWQDKMSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|